Products 1400642-87-6

CAS 1400642-87-6 is the registry number for 9-(tert-Butyl) 2-methyl 1-oxa-4,9-diazaspiro[5.5]undecane-2,9-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

9-O-tert-butyl 2-O-methyl 1-oxa-4,9-diazaspiro[5.5]undecane-2,9-dicarboxylate (CAS 1400642-87-6) is a chemical compound with the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. IUPAC name: 9-O-tert-butyl 2-O-methyl 1-oxa-4,9-diazaspiro[5.5]undecane-2,9-dicarboxylate. InChIKey: UTUUVXROBJNESH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O5
Molecular weight314.38 g/mol
IUPAC name9-O-tert-butyl 2-O-methyl 1-oxa-4,9-diazaspiro[5.5]undecane-2,9-dicarboxylate
InChIKeyUTUUVXROBJNESH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)CNCC(O2)C(=O)OC

Computed by PubChem (NCBI)