CAS 216228-85-2 appears in our catalog under these names: 1,4-Di-tert-butyl 2-formylpiperazine-1,4-dicarboxylate, 1,4-Di-tert-butyl 2-formylpiperazine-1,4-dicarboxylate, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
Ditert-butyl 2-formylpiperazine-1,4-dicarboxylate (CAS 216228-85-2) is a chemical compound with the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. IUPAC name: ditert-butyl 2-formylpiperazine-1,4-dicarboxylate. InChIKey: BYGMEAQCXLANNP-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O5 |
|---|---|
| Molecular weight | 314.38 g/mol |
| IUPAC name | ditert-butyl 2-formylpiperazine-1,4-dicarboxylate |
| InChIKey | BYGMEAQCXLANNP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)