Products 459417-40-4
CAS 459417-40-4 appears in our catalog under these names: Di-tert-butyl 6-oxo-1,4-diazepane-1,4-dicarboxylate, 95%, Di–Tert–Butyl 6–Oxo–1，4–Diazepane–1，4–Dicarboxylate, di-tert-butyl 6-oxo-1,4-diazepane-1,4-dicarboxylate, Di-tert-butyl 6-oxo-1,4-diazepane-1,4-dicarboxylate 95+%, Di-tert-butyl 6-oxo-1,4-diazepane-1,4-dicarboxylate, 95+%, 95+%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 0,5g, 50mg.
Ditert-butyl 6-oxo-1,4-diazepane-1,4-dicarboxylate (CAS 459417-40-4) is a chemical compound with the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. IUPAC name: ditert-butyl 6-oxo-1,4-diazepane-1,4-dicarboxylate. InChIKey: PWHYEWGIMWCYTP-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O5 |
|---|---|
| Molecular weight | 314.38 g/mol |
| IUPAC name | ditert-butyl 6-oxo-1,4-diazepane-1,4-dicarboxylate |
| InChIKey | PWHYEWGIMWCYTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(=O)C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)