Products 1400644-29-2
CAS 1400644-29-2 is the registry number for Benzyl N-[2-(4-chlorophenyl)propan-2-yl]carbamate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Benzyl N-[2-(4-chlorophenyl)propan-2-yl]carbamate (CAS 1400644-29-2) is a chemical compound with the molecular formula C17H18ClNO2 and a molecular weight of 303.8 g/mol. IUPAC name: benzyl N-[2-(4-chlorophenyl)propan-2-yl]carbamate. InChIKey: TZZGUVVTYNUNPY-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO2 |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | benzyl N-[2-(4-chlorophenyl)propan-2-yl]carbamate |
| InChIKey | TZZGUVVTYNUNPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)Cl)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)