CAS 41035-30-7 appears in our catalog under these names: (S)-Apomorphine Hydrochloride, >95% (HPLC), (S)-5,6,6a,7-Tetrahydro-6-methyl- 4H-dibenzo(de,g)quinoline-10,11-diol hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 25mg.
6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrochloride (CAS 41035-30-7) is a chemical compound with the molecular formula C17H18ClNO2 and a molecular weight of 303.8 g/mol. IUPAC name: 6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrochloride. InChIKey: SKYZYDSNJIOXRL-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO2 |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydrochloride |
| InChIKey | SKYZYDSNJIOXRL-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C3C1CC4=C(C3=CC=C2)C(=C(C=C4)O)O.Cl |
Computed by PubChem (NCBI)