Products 619319-74-3
CAS 619319-74-3 is the registry number for 2-Chloro-N-(4-methoxybenzyl)-N-(m-tolyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-chloro-N-[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)acetamide (CAS 619319-74-3) is a chemical compound with the molecular formula C17H18ClNO2 and a molecular weight of 303.8 g/mol. IUPAC name: 2-chloro-N-[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)acetamide. InChIKey: LLYXVPSKIZWRGU-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO2 |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 2-chloro-N-[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)acetamide |
| InChIKey | LLYXVPSKIZWRGU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(CC2=CC=C(C=C2)OC)C(=O)CCl |
Computed by PubChem (NCBI)