Products 1400644-55-4
CAS 1400644-55-4 appears in our catalog under these names: Cyclopentyl(quinolin-2-yl)methanamine, 95%, Cyclopentyl(quinolin-2-yl)methanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Cyclopentyl(quinolin-2-yl)methanamine;hydrochloride (CAS 1400644-55-4) is a chemical compound with the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. IUPAC name: cyclopentyl(quinolin-2-yl)methanamine;hydrochloride. InChIKey: FKUALMCWNPCEOZ-UHFFFAOYSA-N.
| Molecular formula | C15H19ClN2 |
|---|---|
| Molecular weight | 262.78 g/mol |
| IUPAC name | cyclopentyl(quinolin-2-yl)methanamine;hydrochloride |
| InChIKey | FKUALMCWNPCEOZ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(C2=NC3=CC=CC=C3C=C2)N.Cl |
Computed by PubChem (NCBI)