CAS 57756-44-2 appears in our catalog under these names: WAY 629 HCl, WAY 629 Hydrochloride, WAY 629 hydrochloride, WAY 629 (hydrochloride). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 50mg, 5mg, 25mg, 50 mg, 10 mg.
7,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),11(16)-tetraene;hydrochloride (CAS 57756-44-2) is a chemical compound with the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. IUPAC name: 7,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),11(16)-tetraene;hydrochloride. InChIKey: PZXUJERSOFOWES-UHFFFAOYSA-N.
| Molecular formula | C15H19ClN2 |
|---|---|
| Molecular weight | 262.78 g/mol |
| IUPAC name | 7,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),11(16)-tetraene;hydrochloride |
| InChIKey | PZXUJERSOFOWES-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=CC=CC4=C3N2CCNC4.Cl |
Computed by PubChem (NCBI)