CAS 145511-51-9 appears in our catalog under these names: (S)-Pirlindole HCl, Pirlindole Impurity 2（(S)-Pirlindole HCl）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene;hydrochloride (CAS 145511-51-9) is a chemical compound with the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. IUPAC name: (5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene;hydrochloride. InChIKey: LIFOOCLGAAEVIF-ZOWNYOTGSA-N.
| Molecular formula | C15H19ClN2 |
|---|---|
| Molecular weight | 262.78 g/mol |
| IUPAC name | (5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene;hydrochloride |
| InChIKey | LIFOOCLGAAEVIF-ZOWNYOTGSA-N |
| SMILES | CC1=CC2=C(C=C1)N3CCN[C@@H]4C3=C2CCC4.Cl |
Computed by PubChem (NCBI)