CAS 1400742-93-9 is the registry number for 4-Bromo-4'-methoxy-3-vinyl-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
1-bromo-2-ethenyl-4-(4-methoxyphenyl)benzene (CAS 1400742-93-9) is a chemical compound with the molecular formula C15H13BrO and a molecular weight of 289.17 g/mol. IUPAC name: 1-bromo-2-ethenyl-4-(4-methoxyphenyl)benzene. InChIKey: VUWQZFQPUXVZAQ-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO |
|---|---|
| Molecular weight | 289.17 g/mol |
| IUPAC name | 1-bromo-2-ethenyl-4-(4-methoxyphenyl)benzene |
| InChIKey | VUWQZFQPUXVZAQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=C(C=C2)Br)C=C |
Computed by PubChem (NCBI)