CAS 62856-20-6 appears in our catalog under these names: 2-(4-Bromophenyl)-1-(p-tolyl)ethanone 95%, 2-(4-Bromophenyl)-1-(p-tolyl)ethanone, 95%, 95%, Ethanone, 2-(4-bromophenyl)-1-(4-methylphenyl)-, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-(4-bromophenyl)-1-(4-methylphenyl)ethanone (CAS 62856-20-6) is a chemical compound with the molecular formula C15H13BrO and a molecular weight of 289.17 g/mol. IUPAC name: 2-(4-bromophenyl)-1-(4-methylphenyl)ethanone. InChIKey: SFAFJUWUWHVTQS-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO |
|---|---|
| Molecular weight | 289.17 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1-(4-methylphenyl)ethanone |
| InChIKey | SFAFJUWUWHVTQS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)