CAS 1565868-91-8 appears in our catalog under these names: 2-Bromo-9,9-dimethyl-9h-xanthene, 95%, 2-Bromo-9,9-dimethyl-9H-xanthene, >98.0%(GC), 2-Bromo-9,9-dimethyl-9H-xanthene, 97%, 97%, 2-Bromo-9,9-dimethyl-9H-xanthene, 97%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
2-bromo-9,9-dimethylxanthene (CAS 1565868-91-8) is a chemical compound with the molecular formula C15H13BrO and a molecular weight of 289.17 g/mol. IUPAC name: 2-bromo-9,9-dimethylxanthene. InChIKey: QCPNMPAEAGVMFA-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO |
|---|---|
| Molecular weight | 289.17 g/mol |
| IUPAC name | 2-bromo-9,9-dimethylxanthene |
| InChIKey | QCPNMPAEAGVMFA-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2OC3=C1C=C(C=C3)Br)C |
Computed by PubChem (NCBI)