CAS 1401068-25-4 appears in our catalog under these names: 2-BROMO-4-IODODIBENZO[B,D]FURAN, 97%, 2-Bromo-4-iododibenzo[b,d]furan, 99%, 2-Bromo-4-iododibenzo[b,d]furan, 99%, 99%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100mg, 100g, 250mg.
2-bromo-4-iododibenzofuran (CAS 1401068-25-4) is a chemical compound with the molecular formula C12H6BrIO and a molecular weight of 372.98 g/mol. IUPAC name: 2-bromo-4-iododibenzofuran. InChIKey: XFUQQJVGELKGMN-UHFFFAOYSA-N.
| Molecular formula | C12H6BrIO |
|---|---|
| Molecular weight | 372.98 g/mol |
| IUPAC name | 2-bromo-4-iododibenzofuran |
| InChIKey | XFUQQJVGELKGMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC(=C3)Br)I |
Computed by PubChem (NCBI)