CAS 916435-45-5 appears in our catalog under these names: 6-Bromo-2-iododibenzofuran, 99%, 99%, 6-Bromo-2-iododibenzo[b,d]furan, 99%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 10g, 5g.
6-bromo-2-iododibenzofuran (CAS 916435-45-5) is a chemical compound with the molecular formula C12H6BrIO and a molecular weight of 372.98 g/mol. IUPAC name: 6-bromo-2-iododibenzofuran. InChIKey: VBKDJWISHQGFML-UHFFFAOYSA-N.
| Molecular formula | C12H6BrIO |
|---|---|
| Molecular weight | 372.98 g/mol |
| IUPAC name | 6-bromo-2-iododibenzofuran |
| InChIKey | VBKDJWISHQGFML-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC3=C2C=C(C=C3)I |
Computed by PubChem (NCBI)