CAS 1822311-11-4 appears in our catalog under these names: 1-Bromo-8-Iododibenzo[B,D]Furan, 98%, 98%, 1-Bromo-8-iododibenzo[b,d]furan, 98%, 1-Bromo-8-iododibenzofuran, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-8-iododibenzofuran (CAS 1822311-11-4) is a chemical compound with the molecular formula C12H6BrIO and a molecular weight of 372.98 g/mol. IUPAC name: 1-bromo-8-iododibenzofuran. InChIKey: KYPNFEBMMQFIDM-UHFFFAOYSA-N.
| Molecular formula | C12H6BrIO |
|---|---|
| Molecular weight | 372.98 g/mol |
| IUPAC name | 1-bromo-8-iododibenzofuran |
| InChIKey | KYPNFEBMMQFIDM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C3=C(O2)C=CC(=C3)I |
Computed by PubChem (NCBI)