CAS 1401233-93-9 is the registry number for (2R)-4-Benzylmorpholine-2-carboxylic acid hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-4-benzylmorpholine-2-carboxylic acid;hydrochloride (CAS 1401233-93-9) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: (2R)-4-benzylmorpholine-2-carboxylic acid;hydrochloride. InChIKey: CEDXMALCJZSQHA-RFVHGSKJSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | (2R)-4-benzylmorpholine-2-carboxylic acid;hydrochloride |
| InChIKey | CEDXMALCJZSQHA-RFVHGSKJSA-N |
| SMILES | C1CO[C@H](CN1CC2=CC=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)