Products 1401233-93-9

CAS 1401233-93-9 is the registry number for (2R)-4-Benzylmorpholine-2-carboxylic acid hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R)-4-benzylmorpholine-2-carboxylic acid;hydrochloride (CAS 1401233-93-9) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: (2R)-4-benzylmorpholine-2-carboxylic acid;hydrochloride. InChIKey: CEDXMALCJZSQHA-RFVHGSKJSA-N.

Identity
Molecular formulaC12H16ClNO3
Molecular weight257.71 g/mol
IUPAC name(2R)-4-benzylmorpholine-2-carboxylic acid;hydrochloride
InChIKeyCEDXMALCJZSQHA-RFVHGSKJSA-N
SMILESC1CO[C@H](CN1CC2=CC=CC=C2)C(=O)O.Cl

Computed by PubChem (NCBI)