CAS 1401817-62-6 is the registry number for 3-Bromo-5-fluoro-N-methyl-2-nitroaniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-bromo-5-fluoro-N-methyl-2-nitroaniline (CAS 1401817-62-6) is a chemical compound with the molecular formula C7H6BrFN2O2 and a molecular weight of 249.04 g/mol. IUPAC name: 3-bromo-5-fluoro-N-methyl-2-nitroaniline. InChIKey: BNPRPWDFMAGZOO-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2O2 |
|---|---|
| Molecular weight | 249.04 g/mol |
| IUPAC name | 3-bromo-5-fluoro-N-methyl-2-nitroaniline |
| InChIKey | BNPRPWDFMAGZOO-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=CC(=C1)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)