CAS 1401912-25-1 is the registry number for 6–Fluorobenzo(e)(1,2,3)oxathiazine 2,2–dioxide. Offered by: GLPBio. Available pack sizes: 100mg.
6-fluoro-1,2lambda6,3-benzoxathiazine 2,2-dioxide (CAS 1401912-25-1) is a chemical compound with the molecular formula C7H4FNO3S and a molecular weight of 201.18 g/mol. IUPAC name: 6-fluoro-1,2lambda6,3-benzoxathiazine 2,2-dioxide. InChIKey: WQVBCXDOUNURFR-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO3S |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 6-fluoro-1,2lambda6,3-benzoxathiazine 2,2-dioxide |
| InChIKey | WQVBCXDOUNURFR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C=NS(=O)(=O)O2 |
Computed by PubChem (NCBI)