CAS 1692870-11-3 is the registry number for 4-cyanophenyl fluoranesulfonate, ≥95%(GC), ≥95%(GC). Offered by: Chemat. Available pack sizes: 100mg.
1-cyano-4-fluorosulfonyloxybenzene (CAS 1692870-11-3) is a chemical compound with the molecular formula C7H4FNO3S and a molecular weight of 201.18 g/mol. IUPAC name: 1-cyano-4-fluorosulfonyloxybenzene. InChIKey: QVLLNLVBRUJXHZ-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO3S |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 1-cyano-4-fluorosulfonyloxybenzene |
| InChIKey | QVLLNLVBRUJXHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OS(=O)(=O)F |
Computed by PubChem (NCBI)