CAS 384-45-2 appears in our catalog under these names: 6-Fluoro-2,3-dihydro-1lambda(6),2-benzothiazole-1,1,3-trione, 95%, 6-Fluorobenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97%, 6-Fluoro-2,3-dihydro-1,2-benzothiazole-1,1,3-trione, 6-Fluorobenzo[d]isothiazol-3(2H)-one 1,1-dioxide, 98%, 98%, 6-FLUORO-2,3-DIHYDRO-1LAMBDA(6),2-BENZOTHIAZOLE-1,1,3-TRIONE, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 50mg, 100mg.
6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one (CAS 384-45-2) is a chemical compound with the molecular formula C7H4FNO3S and a molecular weight of 201.18 g/mol. IUPAC name: 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: KEOZGOWEMVYVGD-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO3S |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 6-fluoro-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | KEOZGOWEMVYVGD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)