CAS 1401942-60-6 is the registry number for Rel-(1R,3S)-4,4-difluorospiro[2.2]pentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5R)-2,2-difluorospiro[2.2]pentane-5-carboxylic acid (CAS 1401942-60-6) is a chemical compound with the molecular formula C6H6F2O2 and a molecular weight of 148.11 g/mol. IUPAC name: (3S,5R)-2,2-difluorospiro[2.2]pentane-5-carboxylic acid. InChIKey: MMJXHXTZGUTWNW-UCORVYFPSA-N.
| Molecular formula | C6H6F2O2 |
|---|---|
| Molecular weight | 148.11 g/mol |
| IUPAC name | (3S,5R)-2,2-difluorospiro[2.2]pentane-5-carboxylic acid |
| InChIKey | MMJXHXTZGUTWNW-UCORVYFPSA-N |
| SMILES | C1[C@H]([C@@]12CC2(F)F)C(=O)O |
Computed by PubChem (NCBI)