Products 1401942-60-6

CAS 1401942-60-6 is the registry number for Rel-(1R,3S)-4,4-difluorospiro[2.2]pentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3S,5R)-2,2-difluorospiro[2.2]pentane-5-carboxylic acid (CAS 1401942-60-6) is a chemical compound with the molecular formula C6H6F2O2 and a molecular weight of 148.11 g/mol. IUPAC name: (3S,5R)-2,2-difluorospiro[2.2]pentane-5-carboxylic acid. InChIKey: MMJXHXTZGUTWNW-UCORVYFPSA-N.

Identity
Molecular formulaC6H6F2O2
Molecular weight148.11 g/mol
IUPAC name(3S,5R)-2,2-difluorospiro[2.2]pentane-5-carboxylic acid
InChIKeyMMJXHXTZGUTWNW-UCORVYFPSA-N
SMILESC1[C@H]([C@@]12CC2(F)F)C(=O)O

Computed by PubChem (NCBI)