Products 2361635-28-9

CAS 2361635-28-9 is the registry number for 4,4-Difluorospiro[2.2]pentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-difluorospiro[2.2]pentane-5-carboxylic acid (CAS 2361635-28-9) is a chemical compound with the molecular formula C6H6F2O2 and a molecular weight of 148.11 g/mol. IUPAC name: 2,2-difluorospiro[2.2]pentane-5-carboxylic acid. InChIKey: MMJXHXTZGUTWNW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6F2O2
Molecular weight148.11 g/mol
IUPAC name2,2-difluorospiro[2.2]pentane-5-carboxylic acid
InChIKeyMMJXHXTZGUTWNW-UHFFFAOYSA-N
SMILESC1C(C12CC2(F)F)C(=O)O

Computed by PubChem (NCBI)