Products 2385817-07-0

CAS 2385817-07-0 is the registry number for 2,2-Difluorobicyclo[1.1.1]pentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-difluorobicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2385817-07-0) is a chemical compound with the molecular formula C6H6F2O2 and a molecular weight of 148.11 g/mol. IUPAC name: 2,2-difluorobicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: QLGGOHGGLOIYFR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6F2O2
Molecular weight148.11 g/mol
IUPAC name2,2-difluorobicyclo[1.1.1]pentane-1-carboxylic acid
InChIKeyQLGGOHGGLOIYFR-UHFFFAOYSA-N
SMILESC1C2CC1(C2(F)F)C(=O)O

Computed by PubChem (NCBI)