CAS 1401961-57-6 is the registry number for 3-(2,4-Dimethylphenyl)-3-oxetanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2,4-dimethylphenyl)oxetan-3-ol (CAS 1401961-57-6) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)oxetan-3-ol. InChIKey: HPNWOTSFCUFBTQ-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)oxetan-3-ol |
| InChIKey | HPNWOTSFCUFBTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2(COC2)O)C |
Computed by PubChem (NCBI)