CAS 1402053-59-1 is the registry number for Carbidopa Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-(propan-2-yldiazenyl)propanoate (CAS 1402053-59-1) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: methyl (2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-(propan-2-yldiazenyl)propanoate. InChIKey: QJAZZVACJALAFB-AWEZNQCLSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-(propan-2-yldiazenyl)propanoate |
| InChIKey | QJAZZVACJALAFB-AWEZNQCLSA-N |
| SMILES | CC(C)N=N[C@@](C)(CC1=CC(=C(C=C1)O)O)C(=O)OC |
Computed by PubChem (NCBI)