Products 1402175-16-9
CAS 1402175-16-9 appears in our catalog under these names: 2-(Benzyloxy)-1-(4-fluorophenyl)ethan-1-one, 95%, 2-(Benzyloxy)-1-(4-fluorophenyl)ethan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-(4-fluorophenyl)-2-phenylmethoxyethanone (CAS 1402175-16-9) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-phenylmethoxyethanone. InChIKey: MQDGSYIJHBYOQX-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-phenylmethoxyethanone |
| InChIKey | MQDGSYIJHBYOQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)