CAS 1402232-92-1 is the registry number for Ethyl 2-oxo-1-(2,2,2-trifluoroethyl)-1,2-dihydropyrimidine-5-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2-oxo-1-(2,2,2-trifluoroethyl)pyrimidine-5-carboxylate (CAS 1402232-92-1) is a chemical compound with the molecular formula C9H9F3N2O3 and a molecular weight of 250.17 g/mol. IUPAC name: ethyl 2-oxo-1-(2,2,2-trifluoroethyl)pyrimidine-5-carboxylate. InChIKey: RMXNANSSOGENFM-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O3 |
|---|---|
| Molecular weight | 250.17 g/mol |
| IUPAC name | ethyl 2-oxo-1-(2,2,2-trifluoroethyl)pyrimidine-5-carboxylate |
| InChIKey | RMXNANSSOGENFM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C(=O)N=C1)CC(F)(F)F |
Computed by PubChem (NCBI)