CAS 1402821-24-2 appears in our catalog under these names: (R)-2-((6-(BENZYLAMINO)-9-PROPYL-9H-PURIN-2-YL)AMINO)BUTAN-1-OL, 95%, 95%, Ca2+ channel agonist 1/ 98.21% (existing batch purity), Ca2+ channel agonist 1, Ca2+ channel agonist 1, 98.87%. Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
(2R)-2-[[6-(benzylamino)-9-propylpurin-2-yl]amino]butan-1-ol (CAS 1402821-24-2) is a chemical compound with the molecular formula C19H26N6O and a molecular weight of 354.4 g/mol. IUPAC name: (2R)-2-[[6-(benzylamino)-9-propylpurin-2-yl]amino]butan-1-ol. InChIKey: LKXPLOHGQSEPEM-OAHLLOKOSA-N.
| Molecular formula | C19H26N6O |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2R)-2-[[6-(benzylamino)-9-propylpurin-2-yl]amino]butan-1-ol |
| InChIKey | LKXPLOHGQSEPEM-OAHLLOKOSA-N |
| SMILES | CCCN1C=NC2=C(N=C(N=C21)N[C@H](CC)CO)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)