CAS 186692-45-5 appears in our catalog under these names: (S)-Roscovitine, (S)-Roscovitine, 99.15%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 50mg, 25mg, 5mg, 10 mg, 50 mg, 10mM/1mL, 5 mg.
(2S)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol (CAS 186692-45-5) is a chemical compound with the molecular formula C19H26N6O and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol. InChIKey: BTIHMVBBUGXLCJ-HNNXBMFYSA-N.
| Molecular formula | C19H26N6O |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol |
| InChIKey | BTIHMVBBUGXLCJ-HNNXBMFYSA-N |
| SMILES | CC[C@@H](CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)