Products 1461717-05-4
CAS 1461717-05-4 is the registry number for Aftin-5, 99.70%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 50 mg, 1 mg, 100 mg.
(2R)-2-[[6-(N-methylanilino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol (CAS 1461717-05-4) is a chemical compound with the molecular formula C19H26N6O and a molecular weight of 354.4 g/mol. IUPAC name: (2R)-2-[[6-(N-methylanilino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol. InChIKey: HYFZLABHJHEEFS-CQSZACIVSA-N.
| Molecular formula | C19H26N6O |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2R)-2-[[6-(N-methylanilino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol |
| InChIKey | HYFZLABHJHEEFS-CQSZACIVSA-N |
| SMILES | CC[C@H](CO)NC1=NC2=C(C(=N1)N(C)C3=CC=CC=C3)N=CN2C(C)C |
Computed by PubChem (NCBI)