Products 140381-46-0
CAS 140381-46-0 appears in our catalog under these names: 6',7'–epoxy Cannabigerol, 6',7'-Epoxy cannabigerol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
2-[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-5-pentylbenzene-1,3-diol (CAS 140381-46-0) is a chemical compound with the molecular formula C21H32O3 and a molecular weight of 332.5 g/mol. IUPAC name: 2-[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-5-pentylbenzene-1,3-diol. InChIKey: JHTVNVIWLKCIEG-OQLLNIDSSA-N.
| Molecular formula | C21H32O3 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | 2-[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-5-pentylbenzene-1,3-diol |
| InChIKey | JHTVNVIWLKCIEG-OQLLNIDSSA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1)O)C/C=C(\C)/CCC2C(O2)(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
6',7'-epoxy Cannabigerol