Products 1403835-46-0
CAS 1403835-46-0 is the registry number for S 38093-2. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg.
4-[3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propoxy]benzamide;hydrochloride (CAS 1403835-46-0) is a chemical compound with the molecular formula C17H25ClN2O2 and a molecular weight of 324.8 g/mol. IUPAC name: 4-[3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propoxy]benzamide;hydrochloride. InChIKey: AFSVOZDCVFYWFG-KBGJBQQCSA-N.
| Molecular formula | C17H25ClN2O2 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 4-[3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propoxy]benzamide;hydrochloride |
| InChIKey | AFSVOZDCVFYWFG-KBGJBQQCSA-N |
| SMILES | C1C[C@@H]2CN(C[C@@H]2C1)CCCOC3=CC=C(C=C3)C(=O)N.Cl |
Computed by PubChem (NCBI)