Products 1714144-91-8

CAS 1714144-91-8 appears in our catalog under these names: Benzyl 2,9-diazaspiro[5.5]undecane-2-carboxylate hydrochloride hydrochloride, 95%, Benzyl 2,9-diazaspiro(5.5)undecane-2-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 2,9-diazaspiro[5.5]undecane-2-carboxylate;hydrochloride (CAS 1714144-91-8) is a chemical compound with the molecular formula C17H25ClN2O2 and a molecular weight of 324.8 g/mol. IUPAC name: benzyl 2,9-diazaspiro[5.5]undecane-2-carboxylate;hydrochloride. InChIKey: JQIQFCMXXVDLDU-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25ClN2O2
Molecular weight324.8 g/mol
IUPAC namebenzyl 2,9-diazaspiro[5.5]undecane-2-carboxylate;hydrochloride
InChIKeyJQIQFCMXXVDLDU-UHFFFAOYSA-N
SMILESC1CC2(CCNCC2)CN(C1)C(=O)OCC3=CC=CC=C3.Cl

Computed by PubChem (NCBI)