Products 2177257-92-8

CAS 2177257-92-8 is the registry number for Benzyl1,8-diazaspiro[4.6]undecane-8-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl 1,9-diazaspiro[4.6]undecane-9-carboxylate;hydrochloride (CAS 2177257-92-8) is a chemical compound with the molecular formula C17H25ClN2O2 and a molecular weight of 324.8 g/mol. IUPAC name: benzyl 1,9-diazaspiro[4.6]undecane-9-carboxylate;hydrochloride. InChIKey: SBWJDNLOQOAUJE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25ClN2O2
Molecular weight324.8 g/mol
IUPAC namebenzyl 1,9-diazaspiro[4.6]undecane-9-carboxylate;hydrochloride
InChIKeySBWJDNLOQOAUJE-UHFFFAOYSA-N
SMILESC1CC2(CCCN(CC2)C(=O)OCC3=CC=CC=C3)NC1.Cl

Computed by PubChem (NCBI)