CAS 1403943-23-6 is the registry number for (S)-2-(1-Aminoethyl)-3-benzylpyrrolo[2,1-f][1,2,4]triazin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1S)-1-aminoethyl]-3-benzylpyrrolo[2,1-f][1,2,4]triazin-4-one (CAS 1403943-23-6) is a chemical compound with the molecular formula C15H16N4O and a molecular weight of 268.31 g/mol. IUPAC name: 2-[(1S)-1-aminoethyl]-3-benzylpyrrolo[2,1-f][1,2,4]triazin-4-one. InChIKey: GAHLKBFLTUXRAF-NSHDSACASA-N.
| Molecular formula | C15H16N4O |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 2-[(1S)-1-aminoethyl]-3-benzylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| InChIKey | GAHLKBFLTUXRAF-NSHDSACASA-N |
| SMILES | C[C@@H](C1=NN2C=CC=C2C(=O)N1CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)