CAS 497060-47-6 is the registry number for 2-amino-1-(1-aza-2-(4-butoxyphenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-amino-3-[(4-butoxyphenyl)methylideneamino]but-2-enedinitrile (CAS 497060-47-6) is a chemical compound with the molecular formula C15H16N4O and a molecular weight of 268.31 g/mol. IUPAC name: (Z)-2-amino-3-[(4-butoxyphenyl)methylideneamino]but-2-enedinitrile. InChIKey: BNJAHKRXYYDKSJ-NHCILGORSA-N.
| Molecular formula | C15H16N4O |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (Z)-2-amino-3-[(4-butoxyphenyl)methylideneamino]but-2-enedinitrile |
| InChIKey | BNJAHKRXYYDKSJ-NHCILGORSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)