CAS 355818-00-7 appears in our catalog under these names: 2-(4-Ethoxyphenyl)-6-methyl-2h-1,2,3-benzotriazol-5-amine, 95%, 2-(4-Ethoxyphenyl)-6-methyl-2H-benzo[d][1,2,3]triazol-5-amine 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-amine (CAS 355818-00-7) is a chemical compound with the molecular formula C15H16N4O and a molecular weight of 268.31 g/mol. IUPAC name: 2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-amine. InChIKey: CJWZEJBAZIUQNX-UHFFFAOYSA-N.
| Molecular formula | C15H16N4O |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-amine |
| InChIKey | CJWZEJBAZIUQNX-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2N=C3C=C(C(=CC3=N2)N)C |
Computed by PubChem (NCBI)