Products 1404119-49-8

CAS 1404119-49-8 is the registry number for 6-Bromo-5-fluorobenzo[b]thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-bromo-5-fluoro-1-benzothiophene-2-carboxylic acid (CAS 1404119-49-8) is a chemical compound with the molecular formula C9H4BrFO2S and a molecular weight of 275.10 g/mol. IUPAC name: 6-bromo-5-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: CVMZAKCJTQEANP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4BrFO2S
Molecular weight275.10 g/mol
IUPAC name6-bromo-5-fluoro-1-benzothiophene-2-carboxylic acid
InChIKeyCVMZAKCJTQEANP-UHFFFAOYSA-N
SMILESC1=C2C=C(SC2=CC(=C1F)Br)C(=O)O

Computed by PubChem (NCBI)