CAS 360576-06-3 appears in our catalog under these names: 4-Bromo-7-fluorobenzo(b)thiophene-2-carboxylic acid, 98%, 4-bromo-7-fluoro-benzothiophene-2-carboxylic acid, 97%, 97%, 4-BROMO-7-FLUOROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 25g, 250mg, 500mg, 1g.
4-bromo-7-fluoro-1-benzothiophene-2-carboxylic acid (CAS 360576-06-3) is a chemical compound with the molecular formula C9H4BrFO2S and a molecular weight of 275.10 g/mol. IUPAC name: 4-bromo-7-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: DTEWWEXDVQZZSZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrFO2S |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 4-bromo-7-fluoro-1-benzothiophene-2-carboxylic acid |
| InChIKey | DTEWWEXDVQZZSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=C(SC2=C1F)C(=O)O)Br |
Computed by PubChem (NCBI)