Products 826995-59-9

CAS 826995-59-9 is the registry number for 4-bromo-5-fluoro-benzothiophene-2-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

4-bromo-5-fluoro-1-benzothiophene-2-carboxylic acid (CAS 826995-59-9) is a chemical compound with the molecular formula C9H4BrFO2S and a molecular weight of 275.10 g/mol. IUPAC name: 4-bromo-5-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: BJQKOKOETMCVLV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4BrFO2S
Molecular weight275.10 g/mol
IUPAC name4-bromo-5-fluoro-1-benzothiophene-2-carboxylic acid
InChIKeyBJQKOKOETMCVLV-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C(S2)C(=O)O)C(=C1F)Br

Computed by PubChem (NCBI)