CAS 140413-44-1 appears in our catalog under these names: 2-Chloro-4,6-dimethylnicotinamide, 95%, 2-Chloro-4,6-dimethylnicotinamide, 97%, 2-Chloro-4,6-dimethylnicotinamide, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.
2-chloro-4,6-dimethylpyridine-3-carboxamide (CAS 140413-44-1) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 2-chloro-4,6-dimethylpyridine-3-carboxamide. InChIKey: NNBAGQPBTCYTKF-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-chloro-4,6-dimethylpyridine-3-carboxamide |
| InChIKey | NNBAGQPBTCYTKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)N)Cl)C |
Computed by PubChem (NCBI)