CAS 1404230-46-1 appears in our catalog under these names: 7-Bromo-2,3-dihydrobenzofuran-3-ol, 95%, 7–Bromo–2,3–dihydrobenzofuran–3–ol, 7-Bromo-2,3-dihydrobenzofuran-3-ol, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
7-bromo-2,3-dihydro-1-benzofuran-3-ol (CAS 1404230-46-1) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 215.04 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1-benzofuran-3-ol. InChIKey: YPXQKMUDRAZXCL-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | YPXQKMUDRAZXCL-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC=C2)Br)O |
Computed by PubChem (NCBI)