CAS 2165966-78-7 is the registry number for (3S)-7-bromo-2,3-dihydro-1-benzofuran-3-ol, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(3S)-7-bromo-2,3-dihydro-1-benzofuran-3-ol (CAS 2165966-78-7) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 215.04 g/mol. IUPAC name: (3S)-7-bromo-2,3-dihydro-1-benzofuran-3-ol. InChIKey: YPXQKMUDRAZXCL-SSDOTTSWSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | (3S)-7-bromo-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | YPXQKMUDRAZXCL-SSDOTTSWSA-N |
| SMILES | C1[C@H](C2=C(O1)C(=CC=C2)Br)O |
Computed by PubChem (NCBI)