Products 1448643-24-0
CAS 1448643-24-0 is the registry number for (3R)-7-bromo-2,3-dihydro-1-benzofuran-3-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3R)-7-bromo-2,3-dihydro-1-benzofuran-3-ol (CAS 1448643-24-0) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 215.04 g/mol. IUPAC name: (3R)-7-bromo-2,3-dihydro-1-benzofuran-3-ol. InChIKey: YPXQKMUDRAZXCL-ZETCQYMHSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | (3R)-7-bromo-2,3-dihydro-1-benzofuran-3-ol |
| InChIKey | YPXQKMUDRAZXCL-ZETCQYMHSA-N |
| SMILES | C1[C@@H](C2=C(O1)C(=CC=C2)Br)O |
Computed by PubChem (NCBI)