CAS 1404299-76-8 is the registry number for 3-Bromo-7h-imidazo[1,2-c]pyrrolo[3,2-e]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
5-bromo-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (CAS 1404299-76-8) is a chemical compound with the molecular formula C8H5BrN4 and a molecular weight of 237.06 g/mol. IUPAC name: 5-bromo-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene. InChIKey: WVWIVUBNCHCXIN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | 5-bromo-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| InChIKey | WVWIVUBNCHCXIN-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C3=NC=C(N3C=N2)Br |
Computed by PubChem (NCBI)