CAS 1423037-16-4 is the registry number for 7-Bromo-1-methyl-1,2,3-benzotriazole-5-carbonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
7-bromo-1-methylbenzotriazole-5-carbonitrile (CAS 1423037-16-4) is a chemical compound with the molecular formula C8H5BrN4 and a molecular weight of 237.06 g/mol. IUPAC name: 7-bromo-1-methylbenzotriazole-5-carbonitrile. InChIKey: CAFPOWQQJUJCIW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | 7-bromo-1-methylbenzotriazole-5-carbonitrile |
| InChIKey | CAFPOWQQJUJCIW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2Br)C#N)N=N1 |
Computed by PubChem (NCBI)