Products 56107-97-2
CAS 56107-97-2 is the registry number for 3-(3-Bromophenyl)-1,2,4,5-tetrazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g.
3-(3-bromophenyl)-1,2,4,5-tetrazine (CAS 56107-97-2) is a chemical compound with the molecular formula C8H5BrN4 and a molecular weight of 237.06 g/mol. IUPAC name: 3-(3-bromophenyl)-1,2,4,5-tetrazine. InChIKey: HROAHHOBJHFYKT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | 3-(3-bromophenyl)-1,2,4,5-tetrazine |
| InChIKey | HROAHHOBJHFYKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN=CN=N2 |
Computed by PubChem (NCBI)