CAS 1404431-85-1 is the registry number for tert-Butyl 3-(1-bromoethyl)phenylcarbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-[3-(1-bromoethyl)phenyl]carbamate (CAS 1404431-85-1) is a chemical compound with the molecular formula C13H18BrNO2 and a molecular weight of 300.19 g/mol. IUPAC name: tert-butyl N-[3-(1-bromoethyl)phenyl]carbamate. InChIKey: SJPOOLAFEPROOO-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2 |
|---|---|
| Molecular weight | 300.19 g/mol |
| IUPAC name | tert-butyl N-[3-(1-bromoethyl)phenyl]carbamate |
| InChIKey | SJPOOLAFEPROOO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)NC(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)