Products 140464-70-6

CAS 140464-70-6 is the registry number for 2-(3,5-Dimethoxyphenyl)-1,3-dioxolane, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3,5-dimethoxyphenyl)-1,3-dioxolane (CAS 140464-70-6) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(3,5-dimethoxyphenyl)-1,3-dioxolane. InChIKey: JQNWRIDXOJJUIG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O4
Molecular weight210.23 g/mol
IUPAC name2-(3,5-dimethoxyphenyl)-1,3-dioxolane
InChIKeyJQNWRIDXOJJUIG-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1)C2OCCO2)OC

Computed by PubChem (NCBI)