Products 1404824-58-3
CAS 1404824-58-3 is the registry number for 2-{((tert-Butoxy)carbonyl)(methyl)amino}-2-(2,3-dichlorophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2,3-dichlorophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (CAS 1404824-58-3) is a chemical compound with the molecular formula C14H17Cl2NO4 and a molecular weight of 334.2 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid. InChIKey: ZTCFCPXMNLBKKH-UHFFFAOYSA-N.
| Molecular formula | C14H17Cl2NO4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| InChIKey | ZTCFCPXMNLBKKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C(C1=C(C(=CC=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)